Role |
Reference Substance
|
name | Kaempferol-3-O-alpha-L-rhamnoside |
MPIMP ID | R001726 |
stereoisomer | |
isotopomer | ambient |
formula | C21H20O10 |
molecular mass | 432.378 |
monoisotopic mass | 432.10565 |
InChI | InChI=1/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18+,21-/m0/s1 |
InChIKey | |
supplier | Takayama H, Chiba University, Graduate School of Pharmaceutical Sciences, Inage-ku, Chiba 263-8522, Japan |
supplier code | |
lot | |
purity | |
solubility | |
general | |
amount | |
amount unit | |
store temperature 1 | |
store temperature 2 | |
store dry | |
store under argon | |
store in dark | |
contributing author | Tohge, RIKEN Plant Service Center, Metabolome Analysis Research Team, 1-7-22 Suehiro-cho, Tsurumi-ku, Yokohama, Kanagawa, 230-0045, JAPAN |
date of order | |
date in | |
date out | |
date expired | |
box number | |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%272c13c6a5-dd01-4e12-b1e8-18fe8a62b4de%27) |