Role |
Reference Substance
|
name | Arabidopside D |
MPIMP ID | R001734 |
stereoisomer | |
isotopomer | ambient |
formula | C51H80O17 |
molecular mass | 965.173 |
monoisotopic mass | 964.53956 |
InChI | InChI=1/C51H80O17/c1-3-5-13-21-36-33(25-27-38(36)53)19-15-9-7-11-17-23-42(55)63-30-35(66-43(56)24-18-12-8-10-16-20-34-26-28-39(54)37(34)22-14-6-4-2)31-64-50-49(62)47(60)45(58)41(68-50)32-65-51-48(61)46(59)44(57)40(29-52)67-51/h5-6,13-14,25-28,33-37,40-41,44-52,57-62H,3-4,7-12,15-24,29-32H2,1-2H3/b13-5-,14-6-/t33?,34?,35?,36?,37?,40-,41-,44+,45+,46+,47+,48-,49-,50-,51+/m1/s1 |
InChIKey | |
supplier | Shigemori H, University of Tsukuba, Institute of Applied Biochemistry, Tsukuba 305-8572, Japan |
supplier code | |
lot | |
purity | |
solubility | |
general | |
amount | |
amount unit | |
store temperature 1 | |
store temperature 2 | |
store dry | |
store under argon | |
store in dark | |
contributing author | Okazaki, RIKEN Plant Service Center, Metabolome Analysis Research Team, 1-7-22 Suehiro-cho, Tsurumi-ku, Yokohama, Kanagawa, 230-0045, JAPAN |
date of order | |
date in | |
date out | |
date expired | |
box number | |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2764b6ea6b-f303-4f19-b6f9-cbc4c9104bc6%27) |