Role |
Reference Substance
|
name | Leukotriene E4 |
MPIMP ID | R002899 |
stereoisomer | |
isotopomer | ambient |
formula | C23H37NO5S |
molecular mass | 439.611 |
monoisotopic mass | 439.23925 |
InChI | InChI=1S/C23H37NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h6-7,9-13,16,19-21,25H,2-5,8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b7-6-,10-9-,12-11+,16-13+/t19-,20-,21+/m0/s1 |
InChIKey | OTZRAYGBFWZKMX-FRFVZSDQSA-N |
supplier | Biomol |
supplier code | LE004-0050 |
lot | |
purity | |
solubility | |
general | |
amount | 50 |
amount unit | UG |
store temperature 1 | |
store temperature 2 | ND |
store dry | |
store under argon | |
store in dark | |
contributing author | Fehrle I, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2008-09-27 |
date in | 2008-08-18 |
date out | |
date expired | |
box number | |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27846e0243-0a24-4c38-8cba-8769806de761%27) |