Role |
Reference Substance
|
name | Quinic acid, 1-caffeoyl- |
MPIMP ID | R000055 |
stereoisomer | EZ- |
isotopomer | ambient |
formula | C16H18O9 |
molecular mass | 354.309 |
monoisotopic mass | 354.09509 |
InChI | InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-16(15(23)24)6-11(19)14(22)12(20)7-16/h1-5,11-12,14,17-20,22H,6-7H2,(H,23,24)/t11-,12-,14-,16-/m1/s1 |
InChIKey | GWTUHAXUUFROTF-ZNEHSRBWSA-N |
supplier | Sefkow M, University of Potsdam, Institute of Organic Chemistry and Structure Analysis, Karl-Liebknecht-Strasse 24-25, D-14476 Golm, Germany |
supplier code | |
lot | |
purity | |
solubility | |
general | |
amount | |
amount unit | |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Wiggert D, Erban A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Kopka J), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2004-08-26 |
date out | 2016-01-06 |
date expired | |
box number | |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27a81f5a02-9b07-412a-8f8b-51acc730510a%27) |