| Role |
Reference Substance
|
| name | cis-4,7,10,13,16,19-docosahexaenoic acid |
| MPIMP ID | R000870 |
| stereoisomer | n- |
| isotopomer | ambient |
| formula | C22H32O2 |
| molecular mass | 328.489 |
| monoisotopic mass | 328.24023 |
| InChI | InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | MBMBGCFOFBJSGT-KUBAVDMBSA-N |
| supplier | Sigma |
| supplier code | D2534 |
| lot | 72H78441 |
| purity | 99 |
| solubility | |
| general | |
| amount | 100 |
| amount unit | MG |
| store temperature 1 | -20°C |
| store temperature 2 | -20°C |
| store dry | False |
| store under argon | True |
| store in dark | True |
| contributing author | Catchpole G, Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
| date of order | |
| date in | 2000-01-01 |
| date out | 2010-11-02 |
| date expired | |
| box number | 245 |
| application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2704a2b560-473e-4bd2-ac9a-eec97ed8e090%27) |
