Role |
Reference Substance
|
name | Cytidine |
MPIMP ID | R001389 |
stereoisomer | D-, beta- |
isotopomer | ambient |
formula | C9H13N3O5 |
molecular mass | 243.217 |
monoisotopic mass | 243.08552 |
InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 |
InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N |
supplier | Sigma |
supplier code | 30270 |
lot | 24304096 |
purity | 99 |
solubility | |
general | |
amount | 5 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | True |
store in dark | False |
contributing author | Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2004-11-23 |
date in | 2004-12-08 |
date out | |
date expired | |
box number | 3 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27150d3750-ac43-43c6-b0f8-f7f6b4eff18d%27) |