Role |
Reference Substance
|
name | Kestose, 1- |
MPIMP ID | R000795 |
stereoisomer | |
isotopomer | ambient |
formula | C18H32O16 |
molecular mass | 504.438 |
monoisotopic mass | 504.16904 |
InChI | InChI=1S/C18H32O16/c19-1-6-9(23)12(26)13(27)16(31-6)34-18(15(29)11(25)8(3-21)33-18)5-30-17(4-22)14(28)10(24)7(2-20)32-17/h6-16,19-29H,1-5H2/t6-,7-,8-,9-,10-,11?,12+,13-,14+,15+,16-,17-,18+/m1/s1 |
InChIKey | VAWYEUIPHLMNNF-CMCDSJAFSA-N |
supplier | |
supplier code | |
lot | |
purity | |
solubility | |
general | supplied from researcher, in H2O |
amount | |
amount unit | |
store temperature 1 | -20°C |
store temperature 2 | -20°C |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Eckardt A, Catchpole G, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2000-01-01 |
date in | 2003-05-22 |
date out | |
date expired | |
box number | 207 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2735e5a657-6932-4755-a2a9-2cf20764bf02%27) |