| Role |
Reference Substance
|
| name | O-Acetyl-L-Serine hydrochloride |
| MPIMP ID | R000042 |
| stereoisomer | L- |
| isotopomer | ambient |
| formula | C5H9NO4.ClH |
| molecular mass | 183.590 |
| monoisotopic mass | 183.02984 |
| InChI | InChI=1S/C5H9NO4.ClH/c1-3(7)10-2-4(6)5(8)9;/h4H,2,6H2,1H3,(H,8,9);1H |
| InChIKey | MGQOSZSPKMBSRW-UHFFFAOYSA-N |
| supplier | Sigma |
| supplier code | A6262 |
| lot | 093K5102 |
| purity | |
| solubility | |
| general | Substance not yet fully tested (Sigma) |
| amount | 5 |
| amount unit | G |
| store temperature 1 | -20°C |
| store temperature 2 | -20°C |
| store dry | True |
| store under argon | False |
| store in dark | False |
| contributing author | Basner A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Hoefgen R), Am Muehlenberg 1, D-14476 Golm, Germany |
| date of order | |
| date in | 2000-01-01 |
| date out | |
| date expired | |
| box number | 256 |
| application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2739494af0-911a-4af3-a9f0-1e7cb4d70f2b%27) |
