Role |
Reference Substance
|
name | Thymidine |
MPIMP ID | R000528 |
stereoisomer | D- |
isotopomer | ambient |
formula | C10H14N2O5 |
molecular mass | 242.229 |
monoisotopic mass | 242.09027 |
InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
supplier | Fluka |
supplier code | 89270 |
lot | 383831/1 52798 |
purity | 99.5 |
solubility | |
general | Avoid contact with skin and eyes |
amount | 1 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | True |
store in dark | False |
contributing author | Catchpole G, Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2000-01-01 |
date out | |
date expired | |
box number | 41 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%273dc19159-da8c-44ac-b8f7-7aeb5097e983%27) |