Role |
Reference Substance
|
name | D-Glucuronic acid sodium salt monohydrate |
MPIMP ID | R000203 |
stereoisomer | D- |
isotopomer | ambient |
formula | C6H9O7Na |
molecular mass | 216.121 |
monoisotopic mass | 216.02460 |
InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-5,8-11H,(H,12,13);/q;+1/p-1/t2-,3+,4-,5-;/m0./s1 |
InChIKey | WNFHGZLVUQBPMA-JSCKKFHOSA-M |
supplier | Sigma |
supplier code | G8645 |
lot | 96H5040 |
purity | 98 |
solubility | |
general | |
amount | 5 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Meltendorf M, Erban A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Kopka J), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | |
date out | |
date expired | |
box number | 30 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27485b0fff-410b-428e-b1af-19d2700d1237%27) |