Role |
Reference Substance
|
name | Prostaglandin H2 |
MPIMP ID | R001285 |
stereoisomer | |
isotopomer | ambient |
formula | C20H32O5 |
molecular mass | 352.466 |
monoisotopic mass | 352.22498 |
InChI | InChI=1.12Beta/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h1H3,2-3H2,4H,5-6H2,7H,8-11H2,12-13H,14H2,15-19H,21H,(H,22,23)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
InChIKey | YIBNHAJFJUQSRA-YNNPMVKQSA-N |
supplier | Sigma |
supplier code | P7867 |
lot | 064K0727 |
purity | |
solubility | |
general | highly flammable, toxic |
amount | 1 |
amount unit | MG |
store temperature 1 | -70°C |
store temperature 2 | -80°C |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2004-11-23 |
date in | 2004-12-08 |
date out | |
date expired | |
box number | 333 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2762864d05-71d7-4abf-bcdd-6a055eb299da%27) |