| Role |
Reference Substance
|
| name | Eicosapentaenoic acid, 5,8,11,14,17-(Z,Z,Z,Z,Z)- |
| MPIMP ID | R002887 |
| stereoisomer | n- |
| isotopomer | ambient |
| formula | C20H30O2 |
| molecular mass | 302.452 |
| monoisotopic mass | 302.22458 |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | JAZBEHYOTPTENJ-JLNKQSITSA-N |
| supplier | Fluka |
| supplier code | 44864 |
| lot | 1271727 32406097 |
| purity | 98.5 |
| solubility | |
| general | |
| amount | 100 |
| amount unit | MG |
| store temperature 1 | -20°C |
| store temperature 2 | -20°C |
| store dry | |
| store under argon | True |
| store in dark | |
| contributing author | Fehrle I, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
| date of order | |
| date in | 2008-08-11 |
| date out | |
| date expired | |
| box number | 109 |
| application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2770e5cf42-c634-4ff9-95ed-6c9efbde54f5%27) |
