Role |
Reference Substance
|
name | Eicosapentaenoic acid, 5,8,11,14,17-(Z,Z,Z,Z,Z)- |
MPIMP ID | R002887 |
stereoisomer | n- |
isotopomer | ambient |
formula | C20H30O2 |
molecular mass | 302.452 |
monoisotopic mass | 302.22458 |
InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15- |
InChIKey | JAZBEHYOTPTENJ-JLNKQSITSA-N |
supplier | Fluka |
supplier code | 44864 |
lot | 1271727 32406097 |
purity | 98.5 |
solubility | |
general | |
amount | 100 |
amount unit | MG |
store temperature 1 | -20°C |
store temperature 2 | -20°C |
store dry | |
store under argon | True |
store in dark | |
contributing author | Fehrle I, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2008-08-11 |
date out | |
date expired | |
box number | 109 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2770e5cf42-c634-4ff9-95ed-6c9efbde54f5%27) |