Role |
Reference Substance
|
name | Galactaric acid |
MPIMP ID | R001608 |
stereoisomer | D- |
isotopomer | ambient |
formula | C6H10O8 |
molecular mass | 210.139 |
monoisotopic mass | 210.03757 |
InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4- |
InChIKey | DSLZVSRJTYRBFB-DUHBMQHGSA-N |
supplier | Aldrich |
supplier code | M89617 |
lot | 05722JC |
purity | 97 |
solubility | |
general | |
amount | 5 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Kunert A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2005-04-01 |
date out | |
date expired | |
box number | 16 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%277382ba2a-576d-44a0-b718-14f070ddf8c0%27) |