Role |
Reference Substance
|
name | Homoserine lactone, N-butanoyl- |
MPIMP ID | R000234 |
stereoisomer | |
isotopomer | ambient |
formula | C8H13NO3 |
molecular mass | 171.194 |
monoisotopic mass | 171.08954 |
InChI | InChI=1S/C8H13NO3/c1-2-3-7(10)9-6-4-5-12-8(6)11/h6H,2-5H2,1H3,(H,9,10) |
InChIKey | VFFNZZXXTGXBOG-UHFFFAOYSA-N |
supplier | Fluka |
supplier code | 09945 |
lot | 393192 |
purity | 97 |
solubility | |
general | |
amount | 25 |
amount unit | MG |
store temperature 1 | -20°C |
store temperature 2 | -20°C |
store dry | False |
store under argon | True |
store in dark | False |
contributing author | Wiggert D, Erban A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Kopka J), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2004-08-26 |
date out | |
date expired | |
box number | 272 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%277b4ca36a-f964-45c5-8a8a-626f8d149ce6%27) |