| Role |
Reference Substance
|
| name | palmitoleic acid |
| MPIMP ID | R000832 |
| stereoisomer | n- |
| isotopomer | ambient |
| formula | C16H30O2 |
| molecular mass | 254.409 |
| monoisotopic mass | 254.22458 |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
| InChIKey | SECPZKHBENQXJG-FPLPWBNLSA-N |
| supplier | Sigma |
| supplier code | P9417 |
| lot | 22K1374 |
| purity | |
| solubility | |
| general | light sensitive,store under argon |
| amount | 1 |
| amount unit | G |
| store temperature 1 | -20°C |
| store temperature 2 | -20°C |
| store dry | False |
| store under argon | True |
| store in dark | True |
| contributing author | Eckardt A, Catchpole G, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
| date of order | |
| date in | 2000-01-01 |
| date out | |
| date expired | |
| box number | 207 |
| application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%2782cd147f-ba8f-4f60-a0af-a240053f8c7e%27) |
