Role |
Reference Substance
|
name | Prostaglandin F2Alpha |
MPIMP ID | R000309 |
stereoisomer | |
isotopomer | ambient |
formula | C20H34O5 |
molecular mass | 354.482 |
monoisotopic mass | 354.24063 |
InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
InChIKey | PXGPLTODNUVGFL-YNNPMVKQSA-N |
supplier | Alexis |
supplier code | 340-020-M005 |
lot | L15441 |
purity | 99 |
solubility | 100mg/ml in ethanol, DMSO or dimethyl formamide; 10mg/ml in PBS, pH7,2 |
general | certificate of analysis available |
amount | 5 |
amount unit | MG |
store temperature 1 | -20°C |
store temperature 2 | -20°C |
store dry | True |
store under argon | True |
store in dark | False |
contributing author | Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2005-03-22 |
date in | 2005-04-05 |
date out | |
date expired | |
box number | 251 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%278625f7b7-733a-4ab1-b8b8-739351b04998%27) |