Role |
Reference Substance
|
name | DL-3-Aminoisobutyric acid |
MPIMP ID | R001408 |
stereoisomer | DL- |
isotopomer | ambient |
formula | C4H9NO2 |
molecular mass | 103.120 |
monoisotopic mass | 103.06333 |
InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
InChIKey | QCHPKSFMDHPSNR-UHFFFAOYSA-N |
supplier | Sigma |
supplier code | 08290 |
lot | 014665 |
purity | 99 |
solubility | |
general | |
amount | 1 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | False |
store under argon | False |
store in dark | False |
contributing author | Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | 2004-11-23 |
date in | 2004-12-08 |
date out | |
date expired | |
box number | 9 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%278cf84adb-b4db-4807-ac98-0004247c35df%27) |