Role |
Reference Substance
|
name | Tryptophan |
MPIMP ID | R000539 |
stereoisomer | L- |
isotopomer | ambient |
formula | C11H12N2O2 |
molecular mass | 204.226 |
monoisotopic mass | 204.08988 |
InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 |
InChIKey | QIVBCDIJIAJPQS-VIFPVBQESA-N |
supplier | Fluka |
supplier code | 93660 |
lot | 412549/1 55100 |
purity | 99 |
solubility | |
general | Avoid contact with skin and eyes |
amount | 1 |
amount unit | G |
store temperature 1 | -20°C |
store temperature 2 | -20°C |
store dry | False |
store under argon | False |
store in dark | True |
contributing author | Catchpole G, Boelling C, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2000-01-01 |
date out | |
date expired | |
box number | 201 |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%279f2f591c-6199-43f7-aacd-ab1aed5c5871%27) |