Role |
Reference Substance
|
name | Quercitrin |
MPIMP ID | R001731 |
stereoisomer | |
isotopomer | ambient |
formula | C21H20O11.H2O |
molecular mass | 466.393 |
monoisotopic mass | 466.11113 |
InChI | InChI=1S/C21H20O11.H2O/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8;/h2-7,15,17-18,21-26,28-29H,1H3;1H2/t7-,15-,17+,18+,21-;/m0./s1 |
InChIKey | UGZLJOKGLBVBHF-IKGPWECESA-N |
supplier | Takayama H, Chiba University, Graduate School of Pharmaceutical Sciences, Inage-ku, Chiba 263-8522, Japan |
supplier code | |
lot | |
purity | |
solubility | |
general | |
amount | |
amount unit | |
store temperature 1 | |
store temperature 2 | |
store dry | |
store under argon | |
store in dark | |
contributing author | Tohge, RIKEN Plant Service Center, Metabolome Analysis Research Team, 1-7-22 Suehiro-cho, Tsurumi-ku, Yokohama, Kanagawa, 230-0045, JAPAN |
date of order | |
date in | |
date out | |
date expired | |
box number | |
application/atom+xml | http://gmd.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27bbd4c3f4-d121-45c6-af3e-4919226c3ea8%27) |