| Role |
Reference Substance
|
| name | DL-Isocitric acid |
| MPIMP ID | R000128 |
| stereoisomer | DL- |
| isotopomer | ambient |
| formula | C6H8O7.Na |
| molecular mass | 215.114 |
| monoisotopic mass | 215.01677 |
| InChI | InChI=1S/C6H8O7.Na/c7-3(8)1-2(5(10)11)4(9)6(12)13;/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13); |
| InChIKey | CHFLVYSWZGDPQD-UHFFFAOYSA-N |
| supplier | Sigma |
| supplier code | I1252 |
| lot | 79H3877 |
| purity | 93 |
| solubility | |
| general | |
| amount | 1 |
| amount unit | G |
| store temperature 1 | RT |
| store temperature 2 | RT |
| store dry | True |
| store under argon | False |
| store in dark | False |
| contributing author | Meltendorf M, Erban A, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Kopka J), Am Muehlenberg 1, D-14476 Golm, Germany |
| date of order | |
| date in | 2004-08-26 |
| date out | |
| date expired | |
| box number | 27 |
| application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27d355b1be-fd1c-40a7-b5e5-7b32606d5940%27) |
