Role |
Reference Substance
|
name | Maltotriose |
MPIMP ID | R000440 |
stereoisomer | D- |
isotopomer | ambient |
formula | C18H32O16 |
molecular mass | 504.438 |
monoisotopic mass | 504.16904 |
InChI | InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17-,18-/m1/s1 |
InChIKey | FYGDTMLNYKFZSV-PXXRMHSHSA-N |
supplier | Sigma |
supplier code | M8378 |
lot | 27H0681 |
purity | 95 |
solubility | H2O content 1mol/mol |
general | |
amount | 1 |
amount unit | G |
store temperature 1 | RT |
store temperature 2 | RT |
store dry | True |
store under argon | False |
store in dark | False |
contributing author | Wrede J, Turner J, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | 2000-01-01 |
date out | |
date expired | |
box number | 52 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27dd078631-322e-450a-a0e7-94d0ee8c1377%27) |