Role |
Reference Substance
|
name | Zeatin, 9-beta-ribofuranosyl-, trans- |
MPIMP ID | R003012 |
stereoisomer | E-, D- |
isotopomer | ambient |
formula | C15H21N5O5 |
molecular mass | 351.359 |
monoisotopic mass | 351.15427 |
InChI | InChI=1S/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/b8-2+/t9-,11-,12-,15-/m1/s1 |
InChIKey | GOSWTRUMMSCNCW-HNNGNKQASA-N |
supplier | Sigma-Aldrich |
supplier code | Z0375-5MG |
lot | |
purity | |
solubility | |
general | |
amount | 5 |
amount unit | MG |
store temperature 1 | -20°C |
store temperature 2 | |
store dry | |
store under argon | |
store in dark | |
contributing author | Strehmel N, Max Planck Institute of Molecular Plant Physiology, Department of Molecular Plant Physiology (Prof. Willmitzer L), Am Muehlenberg 1, D-14476 Golm, Germany |
date of order | |
date in | |
date out | |
date expired | |
box number | 203 |
application/atom+xml | http://gmd-dev.mpimp-golm.mpg.de/REST/gmd.svc/ReferenceSubstance(guid%27f4f482c9-be32-4f57-8f2c-1ad537f9fb36%27) |